Products 63294-10-0

CAS 63294-10-0 is the registry number for 2-(4-Fluorophenoxy)-2-methylpropanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

2-(4-fluorophenoxy)-2-methylpropanoyl chloride (CAS 63294-10-0) is a chemical compound with the molecular formula C10H10ClFO2 and a molecular weight of 216.63 g/mol. IUPAC name: 2-(4-fluorophenoxy)-2-methylpropanoyl chloride. InChIKey: BAZSCNDLRZMBRM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClFO2
Molecular weight216.63 g/mol
IUPAC name2-(4-fluorophenoxy)-2-methylpropanoyl chloride
InChIKeyBAZSCNDLRZMBRM-UHFFFAOYSA-N
SMILESCC(C)(C(=O)Cl)OC1=CC=C(C=C1)F

Computed by PubChem (NCBI)