CAS 63294-10-0 is the registry number for 2-(4-Fluorophenoxy)-2-methylpropanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.
2-(4-fluorophenoxy)-2-methylpropanoyl chloride (CAS 63294-10-0) is a chemical compound with the molecular formula C10H10ClFO2 and a molecular weight of 216.63 g/mol. IUPAC name: 2-(4-fluorophenoxy)-2-methylpropanoyl chloride. InChIKey: BAZSCNDLRZMBRM-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO2 |
|---|---|
| Molecular weight | 216.63 g/mol |
| IUPAC name | 2-(4-fluorophenoxy)-2-methylpropanoyl chloride |
| InChIKey | BAZSCNDLRZMBRM-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)Cl)OC1=CC=C(C=C1)F |
Computed by PubChem (NCBI)