Products 340825-20-9
CAS 340825-20-9 is the registry number for Ethyl 2-(3-chloro-4-fluorophenyl)acetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Ethyl 2-(3-chloro-4-fluorophenyl)acetate (CAS 340825-20-9) is a chemical compound with the molecular formula C10H10ClFO2 and a molecular weight of 216.63 g/mol. IUPAC name: ethyl 2-(3-chloro-4-fluorophenyl)acetate. InChIKey: DHLMEXLIAJBVHT-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO2 |
|---|---|
| Molecular weight | 216.63 g/mol |
| IUPAC name | ethyl 2-(3-chloro-4-fluorophenyl)acetate |
| InChIKey | DHLMEXLIAJBVHT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC(=C(C=C1)F)Cl |
Computed by PubChem (NCBI)
Synonyms:
Ethyl (3-chloro-4-fluorophenyl)acetate