Products 1017779-44-0
CAS 1017779-44-0 appears in our catalog under these names: 2-(Difluoromethoxy)-5-fluorobenzoic acid, 2-(Difluoromethoxy)-5-fluorobenzoic acid, 95%, 95%, 2-(Difluoromethoxy)-5-fluorobenzoic acid, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 1g, 100mg, 250mg.
2-(difluoromethoxy)-5-fluorobenzoic acid (CAS 1017779-44-0) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2-(difluoromethoxy)-5-fluorobenzoic acid. InChIKey: IZQYQUSKIYZJCN-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2-(difluoromethoxy)-5-fluorobenzoic acid |
| InChIKey | IZQYQUSKIYZJCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)O)OC(F)F |
Computed by PubChem (NCBI)