Products 1017781-22-4

CAS 1017781-22-4 is the registry number for 5-(4-Methylsulfanyl-phenyl)-1-phenyl-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(4-methylsulfanylphenyl)-1-phenylpyrazole-3-carboxylic acid (CAS 1017781-22-4) is a chemical compound with the molecular formula C17H14N2O2S and a molecular weight of 310.4 g/mol. IUPAC name: 5-(4-methylsulfanylphenyl)-1-phenylpyrazole-3-carboxylic acid. InChIKey: XRSTZRPINLYDRU-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14N2O2S
Molecular weight310.4 g/mol
IUPAC name5-(4-methylsulfanylphenyl)-1-phenylpyrazole-3-carboxylic acid
InChIKeyXRSTZRPINLYDRU-UHFFFAOYSA-N
SMILESCSC1=CC=C(C=C1)C2=CC(=NN2C3=CC=CC=C3)C(=O)O

Computed by PubChem (NCBI)