CAS 554438-65-2 is the registry number for 2-(4-(4-Methylphenyl)-2-(pyridin-3-yl)-1,3-thiazol-5-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[4-(4-methylphenyl)-2-pyridin-3-yl-1,3-thiazol-5-yl]acetic acid (CAS 554438-65-2) is a chemical compound with the molecular formula C17H14N2O2S and a molecular weight of 310.4 g/mol. IUPAC name: 2-[4-(4-methylphenyl)-2-pyridin-3-yl-1,3-thiazol-5-yl]acetic acid. InChIKey: HPGOPLQHCDPWKE-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2S |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 2-[4-(4-methylphenyl)-2-pyridin-3-yl-1,3-thiazol-5-yl]acetic acid |
| InChIKey | HPGOPLQHCDPWKE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(SC(=N2)C3=CN=CC=C3)CC(=O)O |
Computed by PubChem (NCBI)