Products 554438-65-2

CAS 554438-65-2 is the registry number for 2-(4-(4-Methylphenyl)-2-(pyridin-3-yl)-1,3-thiazol-5-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-[4-(4-methylphenyl)-2-pyridin-3-yl-1,3-thiazol-5-yl]acetic acid (CAS 554438-65-2) is a chemical compound with the molecular formula C17H14N2O2S and a molecular weight of 310.4 g/mol. IUPAC name: 2-[4-(4-methylphenyl)-2-pyridin-3-yl-1,3-thiazol-5-yl]acetic acid. InChIKey: HPGOPLQHCDPWKE-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14N2O2S
Molecular weight310.4 g/mol
IUPAC name2-[4-(4-methylphenyl)-2-pyridin-3-yl-1,3-thiazol-5-yl]acetic acid
InChIKeyHPGOPLQHCDPWKE-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=C(SC(=N2)C3=CN=CC=C3)CC(=O)O

Computed by PubChem (NCBI)