CAS 2383046-53-3 is the registry number for (E)-N'-(Naphthalen-2-ylmethylene)benzenesulfonohydrazide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
N-[(E)-naphthalen-2-ylmethylideneamino]benzenesulfonamide (CAS 2383046-53-3) is a chemical compound with the molecular formula C17H14N2O2S and a molecular weight of 310.4 g/mol. IUPAC name: N-[(E)-naphthalen-2-ylmethylideneamino]benzenesulfonamide. InChIKey: PUIRGFSNYMXSDA-QGOAFFKASA-N.
| Molecular formula | C17H14N2O2S |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | N-[(E)-naphthalen-2-ylmethylideneamino]benzenesulfonamide |
| InChIKey | PUIRGFSNYMXSDA-QGOAFFKASA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)