Products 745789-70-2
CAS 745789-70-2 appears in our catalog under these names: WAY–621924, N-(4-Methyl-2-thiazolyl)-3-phenoxybenzamide, 98%, 98%, WAY-621924, 98.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 250mg, 10 mg, 5 mg.
N-(4-methyl-1,3-thiazol-2-yl)-3-phenoxybenzamide (CAS 745789-70-2) is a chemical compound with the molecular formula C17H14N2O2S and a molecular weight of 310.4 g/mol. IUPAC name: N-(4-methyl-1,3-thiazol-2-yl)-3-phenoxybenzamide. InChIKey: KZKCURLGSBGETL-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2S |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | N-(4-methyl-1,3-thiazol-2-yl)-3-phenoxybenzamide |
| InChIKey | KZKCURLGSBGETL-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)NC(=O)C2=CC(=CC=C2)OC3=CC=CC=C3 |
Computed by PubChem (NCBI)