CAS 1017782-52-3 is the registry number for [5-(4-Chlorophenyl)-1,3,4-oxadiazol-2-yl]-n-methylmethanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine (CAS 1017782-52-3) is a chemical compound with the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. IUPAC name: 1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine. InChIKey: CGESIXVBLHONGT-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O |
|---|---|
| Molecular weight | 223.66 g/mol |
| IUPAC name | 1-[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-methylmethanamine |
| InChIKey | CGESIXVBLHONGT-UHFFFAOYSA-N |
| SMILES | CNCC1=NN=C(O1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)