CAS 453548-76-0 is the registry number for 1-(6-Chloro-7,8-dimethylimidazo[1,2-b]pyridazin-3-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(6-chloro-7,8-dimethylimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS 453548-76-0) is a chemical compound with the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. IUPAC name: 1-(6-chloro-7,8-dimethylimidazo[1,2-b]pyridazin-3-yl)ethanone. InChIKey: ADSOFRZDDIMQPF-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O |
|---|---|
| Molecular weight | 223.66 g/mol |
| IUPAC name | 1-(6-chloro-7,8-dimethylimidazo[1,2-b]pyridazin-3-yl)ethanone |
| InChIKey | ADSOFRZDDIMQPF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN2C1=NC=C2C(=O)C)Cl)C |
Computed by PubChem (NCBI)