CAS 1226804-08-5 is the registry number for 4'-Chlorospiro[cyclopentane-1,5'-pyrrolo[2,3-d]pyrimidin]-6'(7'H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chlorospiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopentane]-6-one (CAS 1226804-08-5) is a chemical compound with the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. IUPAC name: 4-chlorospiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopentane]-6-one. InChIKey: NWXFTSULCLLWEX-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O |
|---|---|
| Molecular weight | 223.66 g/mol |
| IUPAC name | 4-chlorospiro[7H-pyrrolo[2,3-d]pyrimidine-5,1'-cyclopentane]-6-one |
| InChIKey | NWXFTSULCLLWEX-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)C3=C(NC2=O)N=CN=C3Cl |
Computed by PubChem (NCBI)