CAS 4469-02-7 is the registry number for 5-(4-Chlorophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-chlorophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine (CAS 4469-02-7) is a chemical compound with the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. IUPAC name: 5-(4-chlorophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine. InChIKey: MYGKAVHQHCUMIZ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O |
|---|---|
| Molecular weight | 223.66 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-N,N-dimethyl-1,3,4-oxadiazol-2-amine |
| InChIKey | MYGKAVHQHCUMIZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NN=C(O1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)