CAS 1017788-66-7 appears in our catalog under these names: 4-Chloro-7-hydroxyquinoline-3-carbonitrile, 95%, 4-Chloro-7-hydroxy-quinoline-3-carbonitrile, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4-chloro-7-hydroxyquinoline-3-carbonitrile (CAS 1017788-66-7) is a chemical compound with the molecular formula C10H5ClN2O and a molecular weight of 204.61 g/mol. IUPAC name: 4-chloro-7-hydroxyquinoline-3-carbonitrile. InChIKey: ATENTCYDIFPJRQ-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN2O |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 4-chloro-7-hydroxyquinoline-3-carbonitrile |
| InChIKey | ATENTCYDIFPJRQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C=C1O)C#N)Cl |
Computed by PubChem (NCBI)