CAS 39876-88-5 appears in our catalog under these names: 4–Chlorobenzofuro(3,2–d)pyrimidine, 4-Chlorobenzofuro[3,2-d]pyrimidine, >98.0%(GC), 4-Chlorobenzofuro[3,2-d]pyrimidine 98%, 4-Chlorobenzofuro[3,2-d]Pyrimidine, 98%, 98%, 4-Chlorobenzofuro[3,2-d]pyrimidine, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 200mg, 250mg.
4-chloro-[1]benzofuro[3,2-d]pyrimidine (CAS 39876-88-5) is a chemical compound with the molecular formula C10H5ClN2O and a molecular weight of 204.61 g/mol. IUPAC name: 4-chloro-[1]benzofuro[3,2-d]pyrimidine. InChIKey: ABRHSRPOYMSBOI-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN2O |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 4-chloro-[1]benzofuro[3,2-d]pyrimidine |
| InChIKey | ABRHSRPOYMSBOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)