Products 946385-82-6
CAS 946385-82-6 is the registry number for 2-Chloro-6-(2-furyl)nicotinonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-chloro-6-(furan-2-yl)pyridine-3-carbonitrile (CAS 946385-82-6) is a chemical compound with the molecular formula C10H5ClN2O and a molecular weight of 204.61 g/mol. IUPAC name: 2-chloro-6-(furan-2-yl)pyridine-3-carbonitrile. InChIKey: HMPRWDLTTCZMAY-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN2O |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 2-chloro-6-(furan-2-yl)pyridine-3-carbonitrile |
| InChIKey | HMPRWDLTTCZMAY-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC(=C(C=C2)C#N)Cl |
Computed by PubChem (NCBI)