CAS 61338-25-8 is the registry number for 8-Chloro-4-hydroxyquinoline-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
8-chloro-4-oxo-1H-quinoline-3-carbonitrile (CAS 61338-25-8) is a chemical compound with the molecular formula C10H5ClN2O and a molecular weight of 204.61 g/mol. IUPAC name: 8-chloro-4-oxo-1H-quinoline-3-carbonitrile. InChIKey: UFCSVGOSWWHTES-UHFFFAOYSA-N.
| Molecular formula | C10H5ClN2O |
|---|---|
| Molecular weight | 204.61 g/mol |
| IUPAC name | 8-chloro-4-oxo-1H-quinoline-3-carbonitrile |
| InChIKey | UFCSVGOSWWHTES-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC=C(C2=O)C#N |
Computed by PubChem (NCBI)