Products 10178-55-9
CAS 10178-55-9 appears in our catalog under these names: 7-Chloro-2,2-dimethyl-2,3-dihydro-1-benzofuran, 95%, 7-Chloro-2,2-dimethyl-2,3-dihydro-1-benzofuran, 7-Chloro-2,2-dimethyl-2,3-dihydrobenzofuran, 95%, 95%, 7-Chloro-2,2-dimethyl-2,3-dihydrobenzofuran, 95%. Offered by: Combi-blocks, Biosynth, Chemat, HPC Standards, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g, 1x100mg.
7-chloro-2,2-dimethyl-3H-1-benzofuran (CAS 10178-55-9) is a chemical compound with the molecular formula C10H11ClO and a molecular weight of 182.64 g/mol. IUPAC name: 7-chloro-2,2-dimethyl-3H-1-benzofuran. InChIKey: HQNCYHHQGGYKRZ-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO |
|---|---|
| Molecular weight | 182.64 g/mol |
| IUPAC name | 7-chloro-2,2-dimethyl-3H-1-benzofuran |
| InChIKey | HQNCYHHQGGYKRZ-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)Cl)C |
Computed by PubChem (NCBI)