Products 1017857-64-5
CAS 1017857-64-5 is the registry number for 2,2'-Dihydroxy-[1,1'-binaphthalene]-5,5'-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(5-carboxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalene-1-carboxylic acid (CAS 1017857-64-5) is a chemical compound with the molecular formula C22H14O6 and a molecular weight of 374.3 g/mol. IUPAC name: 5-(5-carboxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalene-1-carboxylic acid. InChIKey: XAQWSUIEIBDENV-UHFFFAOYSA-N.
| Molecular formula | C22H14O6 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 5-(5-carboxy-2-hydroxynaphthalen-1-yl)-6-hydroxynaphthalene-1-carboxylic acid |
| InChIKey | XAQWSUIEIBDENV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C3=C(C=CC4=C3C=CC=C4C(=O)O)O)O)C(=C1)C(=O)O |
Computed by PubChem (NCBI)