Products 2409130-70-5
CAS 2409130-70-5 appears in our catalog under these names: 4,4''-Diformyl-[1,1':4',1''-terphenyl]-2',5'-dicarboxylic acid, 98%, 98%, 4,4''-Diformyl-[1,1':4',1''-terphenyl]-2',5'-dicarboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,5-bis(4-formylphenyl)terephthalic acid (CAS 2409130-70-5) is a chemical compound with the molecular formula C22H14O6 and a molecular weight of 374.3 g/mol. IUPAC name: 2,5-bis(4-formylphenyl)terephthalic acid. InChIKey: BNCRLOUOMWVMRZ-UHFFFAOYSA-N.
| Molecular formula | C22H14O6 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 2,5-bis(4-formylphenyl)terephthalic acid |
| InChIKey | BNCRLOUOMWVMRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=C(C=C2C(=O)O)C3=CC=C(C=C3)C=O)C(=O)O |
Computed by PubChem (NCBI)