Products 52497-37-7
CAS 52497-37-7 is the registry number for 1,4-Benzenedicarboxylic acid, 2,5-dibenzoyl-, 95%, 95%. Offered by: Chemat. Available pack sizes: 200mg, 1g, 5g.
2,5-dibenzoylterephthalic acid (CAS 52497-37-7) is a chemical compound with the molecular formula C22H14O6 and a molecular weight of 374.3 g/mol. IUPAC name: 2,5-dibenzoylterephthalic acid. InChIKey: DOMZJLXGHYKACV-UHFFFAOYSA-N.
| Molecular formula | C22H14O6 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 2,5-dibenzoylterephthalic acid |
| InChIKey | DOMZJLXGHYKACV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2C(=O)O)C(=O)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)