CAS 47568-49-0 is the registry number for [1,1'-Binaphthalene]-3,3'-dicarboxylicacid, 2,2'-dihydroxy-, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(3-carboxy-2-hydroxynaphthalen-1-yl)-3-hydroxynaphthalene-2-carboxylic acid (CAS 47568-49-0) is a chemical compound with the molecular formula C22H14O6 and a molecular weight of 374.3 g/mol. IUPAC name: 4-(3-carboxy-2-hydroxynaphthalen-1-yl)-3-hydroxynaphthalene-2-carboxylic acid. InChIKey: GYJACFGQPFXKCA-UHFFFAOYSA-N.
| Molecular formula | C22H14O6 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 4-(3-carboxy-2-hydroxynaphthalen-1-yl)-3-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | GYJACFGQPFXKCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2C3=C(C(=CC4=CC=CC=C43)C(=O)O)O)O)C(=O)O |
Computed by PubChem (NCBI)