CAS 1018051-51-8 appears in our catalog under these names: 5-(4-Methoxyphenyl)-4,5-dihydroisoxazole-3-carboxylic acid, 97%, 5-(4-Methoxyphenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid, 5-(4-Methoxyphenyl)-4,5-dihydroisoxazole-3-carboxylic acid, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 1g, 250mg, 5g, 50mg, 500mg, 2.5g.
5-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid (CAS 1018051-51-8) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 5-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid. InChIKey: ICBZRFUYAIZNTN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| InChIKey | ICBZRFUYAIZNTN-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)