CAS 1018052-74-8 is the registry number for 4-(5-Methylthiophen-2-yl)-1,2,3-thiadiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(5-methylthiophen-2-yl)thiadiazole-5-carboxylic acid (CAS 1018052-74-8) is a chemical compound with the molecular formula C8H6N2O2S2 and a molecular weight of 226.3 g/mol. IUPAC name: 4-(5-methylthiophen-2-yl)thiadiazole-5-carboxylic acid. InChIKey: PNKYFFDSOCEBRT-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S2 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 4-(5-methylthiophen-2-yl)thiadiazole-5-carboxylic acid |
| InChIKey | PNKYFFDSOCEBRT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)C2=C(SN=N2)C(=O)O |
Computed by PubChem (NCBI)