Products 1018052-74-8

CAS 1018052-74-8 is the registry number for 4-(5-Methylthiophen-2-yl)-1,2,3-thiadiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(5-methylthiophen-2-yl)thiadiazole-5-carboxylic acid (CAS 1018052-74-8) is a chemical compound with the molecular formula C8H6N2O2S2 and a molecular weight of 226.3 g/mol. IUPAC name: 4-(5-methylthiophen-2-yl)thiadiazole-5-carboxylic acid. InChIKey: PNKYFFDSOCEBRT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2O2S2
Molecular weight226.3 g/mol
IUPAC name4-(5-methylthiophen-2-yl)thiadiazole-5-carboxylic acid
InChIKeyPNKYFFDSOCEBRT-UHFFFAOYSA-N
SMILESCC1=CC=C(S1)C2=C(SN=N2)C(=O)O

Computed by PubChem (NCBI)