CAS 3621-99-6 appears in our catalog under these names: 2-(methylthio)-6-nitro-1,3-benzothiazole, 97%, 2-(Methylthio)-6-nitrobenzo[d]thiazole, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-methylsulfanyl-6-nitro-1,3-benzothiazole (CAS 3621-99-6) is a chemical compound with the molecular formula C8H6N2O2S2 and a molecular weight of 226.3 g/mol. IUPAC name: 2-methylsulfanyl-6-nitro-1,3-benzothiazole. InChIKey: UGURRSVQWLYDOY-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S2 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 2-methylsulfanyl-6-nitro-1,3-benzothiazole |
| InChIKey | UGURRSVQWLYDOY-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(S1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)