CAS 18740-26-6 is the registry number for 2-{Thieno(2,3-d)pyrimidin-4-ylsulfanyl}acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetic acid (CAS 18740-26-6) is a chemical compound with the molecular formula C8H6N2O2S2 and a molecular weight of 226.3 g/mol. IUPAC name: 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetic acid. InChIKey: DXFKYUFRYZVSAN-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S2 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 2-thieno[2,3-d]pyrimidin-4-ylsulfanylacetic acid |
| InChIKey | DXFKYUFRYZVSAN-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=NC=N2)SCC(=O)O |
Computed by PubChem (NCBI)