Products 91520-83-1

CAS 91520-83-1 is the registry number for 2'-Methyl-[2,4'-bithiazole]-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylic acid (CAS 91520-83-1) is a chemical compound with the molecular formula C8H6N2O2S2 and a molecular weight of 226.3 g/mol. IUPAC name: 2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: LLDGWHFDLMKSGO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2O2S2
Molecular weight226.3 g/mol
IUPAC name2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylic acid
InChIKeyLLDGWHFDLMKSGO-UHFFFAOYSA-N
SMILESCC1=NC(=CS1)C2=NC(=CS2)C(=O)O

Computed by PubChem (NCBI)