CAS 91520-83-1 is the registry number for 2'-Methyl-[2,4'-bithiazole]-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylic acid (CAS 91520-83-1) is a chemical compound with the molecular formula C8H6N2O2S2 and a molecular weight of 226.3 g/mol. IUPAC name: 2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: LLDGWHFDLMKSGO-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S2 |
|---|---|
| Molecular weight | 226.3 g/mol |
| IUPAC name | 2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | LLDGWHFDLMKSGO-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)