CAS 1018127-33-7 is the registry number for 3-(3-Methoxyphenyl)-6-(propan-2-yl)-(1,2)oxazolo(5,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(3-methoxyphenyl)-6-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid (CAS 1018127-33-7) is a chemical compound with the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. IUPAC name: 3-(3-methoxyphenyl)-6-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: GOMRTBLXESXNNC-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O4 |
|---|---|
| Molecular weight | 312.32 g/mol |
| IUPAC name | 3-(3-methoxyphenyl)-6-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | GOMRTBLXESXNNC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=C(C(=C1)C(=O)O)C(=NO2)C3=CC(=CC=C3)OC |
Computed by PubChem (NCBI)