Products 304667-93-4

CAS 304667-93-4 is the registry number for 4-(2-([1,1'-Biphenyl]-4-carbonyl)hydrazinyl)-4-oxobutanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-oxo-4-[2-(4-phenylbenzoyl)hydrazinyl]butanoic acid (CAS 304667-93-4) is a chemical compound with the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. IUPAC name: 4-oxo-4-[2-(4-phenylbenzoyl)hydrazinyl]butanoic acid. InChIKey: KCZUNCVPWCFNQF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16N2O4
Molecular weight312.32 g/mol
IUPAC name4-oxo-4-[2-(4-phenylbenzoyl)hydrazinyl]butanoic acid
InChIKeyKCZUNCVPWCFNQF-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)NNC(=O)CCC(=O)O

Computed by PubChem (NCBI)