CAS 2402-44-0 is the registry number for 5,5-Bis(4-methoxyphenyl)imidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione (CAS 2402-44-0) is a chemical compound with the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. IUPAC name: 5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione. InChIKey: HUULDKVZAIILJR-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O4 |
|---|---|
| Molecular weight | 312.32 g/mol |
| IUPAC name | 5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione |
| InChIKey | HUULDKVZAIILJR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2(C(=O)NC(=O)N2)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)