Products 2873410-82-1
CAS 2873410-82-1 is the registry number for Dimethyl 2-(quinoxalin-6-yl)bicyclo[1.1.1]pentane-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 2-quinoxalin-6-ylbicyclo[1.1.1]pentane-1,3-dicarboxylate (CAS 2873410-82-1) is a chemical compound with the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. IUPAC name: dimethyl 2-quinoxalin-6-ylbicyclo[1.1.1]pentane-1,3-dicarboxylate. InChIKey: DYOUKNCPMVPCTO-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O4 |
|---|---|
| Molecular weight | 312.32 g/mol |
| IUPAC name | dimethyl 2-quinoxalin-6-ylbicyclo[1.1.1]pentane-1,3-dicarboxylate |
| InChIKey | DYOUKNCPMVPCTO-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(C2C3=CC4=NC=CN=C4C=C3)C(=O)OC |
Computed by PubChem (NCBI)