CAS 1018143-20-8 is the registry number for 3-(3-Methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(3-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 1018143-20-8) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 3-(3-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: NJIQUJAJLOOAOX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 3-(3-methoxyphenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | NJIQUJAJLOOAOX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NOC(C2)C(=O)O |
Computed by PubChem (NCBI)