CAS 101820-69-3 appears in our catalog under these names: Minodronic acid InterMediate A, Minodronic Acid Impurity 9, Ethyl 2–(imidazo(1,2–a)pyridin–3–yl)acetate, Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate 97%, Imidazo[1,2-a]pyridine-3-acetic acid,ethyl ester, 97%, 97%. Offered by: Chemat Brand, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 1g, 5g, 100mg, 250mg, 25g, 10g.
Ethyl 2-imidazo[1,2-a]pyridin-3-ylacetate (CAS 101820-69-3) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: ethyl 2-imidazo[1,2-a]pyridin-3-ylacetate. InChIKey: SFCNXCZZKZRJLZ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | ethyl 2-imidazo[1,2-a]pyridin-3-ylacetate |
| InChIKey | SFCNXCZZKZRJLZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CN=C2N1C=CC=C2 |
Computed by PubChem (NCBI)