Products 1018498-30-0
CAS 1018498-30-0 appears in our catalog under these names: 2-(2-Chlorophenyl)-2,3-dihydrobenzo(d)oxazole-5-carboxylic Acid, >95% (HPLC), 2-(2-Chlorophenyl)-1,3-benzoxazole-5-carboxylic acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 50mg, 0,5g.
2-(2-chlorophenyl)-1,3-benzoxazole-5-carboxylic acid (CAS 1018498-30-0) is a chemical compound with the molecular formula C14H8ClNO3 and a molecular weight of 273.67 g/mol. IUPAC name: 2-(2-chlorophenyl)-1,3-benzoxazole-5-carboxylic acid. InChIKey: RQMFSMZMURCTTR-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO3 |
|---|---|
| Molecular weight | 273.67 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1,3-benzoxazole-5-carboxylic acid |
| InChIKey | RQMFSMZMURCTTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=C(O2)C=CC(=C3)C(=O)O)Cl |
Computed by PubChem (NCBI)