Products 884849-06-3
CAS 884849-06-3 is the registry number for 4-(5-Chlorobenzo[d]oxazol-2-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(5-chloro-1,3-benzoxazol-2-yl)benzoic acid (CAS 884849-06-3) is a chemical compound with the molecular formula C14H8ClNO3 and a molecular weight of 273.67 g/mol. IUPAC name: 4-(5-chloro-1,3-benzoxazol-2-yl)benzoic acid. InChIKey: RKFQXPZCXWRHGF-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO3 |
|---|---|
| Molecular weight | 273.67 g/mol |
| IUPAC name | 4-(5-chloro-1,3-benzoxazol-2-yl)benzoic acid |
| InChIKey | RKFQXPZCXWRHGF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(O2)C=CC(=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)