Products 1315368-61-6
CAS 1315368-61-6 appears in our catalog under these names: 3-(4-Chloro-2-cyanophenoxy)benzoic acid, 95%, 3-(4-Chloro-2-cyanophenoxy)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-(4-chloro-2-cyanophenoxy)benzoic acid (CAS 1315368-61-6) is a chemical compound with the molecular formula C14H8ClNO3 and a molecular weight of 273.67 g/mol. IUPAC name: 3-(4-chloro-2-cyanophenoxy)benzoic acid. InChIKey: HDWIYYARUFAODH-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO3 |
|---|---|
| Molecular weight | 273.67 g/mol |
| IUPAC name | 3-(4-chloro-2-cyanophenoxy)benzoic acid |
| InChIKey | HDWIYYARUFAODH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=C(C=C(C=C2)Cl)C#N)C(=O)O |
Computed by PubChem (NCBI)