Products 1281803-67-5

CAS 1281803-67-5 is the registry number for 3-Chloro-4-(2-cyanophenoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-chloro-4-(2-cyanophenoxy)benzoic acid (CAS 1281803-67-5) is a chemical compound with the molecular formula C14H8ClNO3 and a molecular weight of 273.67 g/mol. IUPAC name: 3-chloro-4-(2-cyanophenoxy)benzoic acid. InChIKey: FLWFXICVOGXLHF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8ClNO3
Molecular weight273.67 g/mol
IUPAC name3-chloro-4-(2-cyanophenoxy)benzoic acid
InChIKeyFLWFXICVOGXLHF-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C#N)OC2=C(C=C(C=C2)C(=O)O)Cl

Computed by PubChem (NCBI)