Products 1281803-67-5
CAS 1281803-67-5 is the registry number for 3-Chloro-4-(2-cyanophenoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-chloro-4-(2-cyanophenoxy)benzoic acid (CAS 1281803-67-5) is a chemical compound with the molecular formula C14H8ClNO3 and a molecular weight of 273.67 g/mol. IUPAC name: 3-chloro-4-(2-cyanophenoxy)benzoic acid. InChIKey: FLWFXICVOGXLHF-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO3 |
|---|---|
| Molecular weight | 273.67 g/mol |
| IUPAC name | 3-chloro-4-(2-cyanophenoxy)benzoic acid |
| InChIKey | FLWFXICVOGXLHF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)OC2=C(C=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)