Products 1018517-02-6
CAS 1018517-02-6 is the registry number for 3-Benzylimidazo[1,5-a]pyridine-1-carboxylic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
3-benzylimidazo[1,5-a]pyridine-1-carboxylic acid (CAS 1018517-02-6) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 3-benzylimidazo[1,5-a]pyridine-1-carboxylic acid. InChIKey: UBPINVMHWWSCRI-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 3-benzylimidazo[1,5-a]pyridine-1-carboxylic acid |
| InChIKey | UBPINVMHWWSCRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=C3N2C=CC=C3)C(=O)O |
Computed by PubChem (NCBI)