CAS 101853-12-7 appears in our catalog under these names: 5-tert-Butyl-4-phenyl-1,3-thiazol-2-amine, 95%, 5-(tert-Butyl)-4-phenylthiazol-2-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-tert-butyl-4-phenyl-1,3-thiazol-2-amine (CAS 101853-12-7) is a chemical compound with the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. IUPAC name: 5-tert-butyl-4-phenyl-1,3-thiazol-2-amine. InChIKey: CNMGPWGMAPXPOX-UHFFFAOYSA-N.
| Molecular formula | C13H16N2S |
|---|---|
| Molecular weight | 232.35 g/mol |
| IUPAC name | 5-tert-butyl-4-phenyl-1,3-thiazol-2-amine |
| InChIKey | CNMGPWGMAPXPOX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(N=C(S1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)