CAS 2760268-02-6 is the registry number for 5-((2R,5S)-5-Methylpiperidin-2-yl)benzo[d]thiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(2R,5S)-5-methylpiperidin-2-yl]-1,3-benzothiazole (CAS 2760268-02-6) is a chemical compound with the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. IUPAC name: 5-[(2R,5S)-5-methylpiperidin-2-yl]-1,3-benzothiazole. InChIKey: UPSVNOIRQLCAMG-GXSJLCMTSA-N.
| Molecular formula | C13H16N2S |
|---|---|
| Molecular weight | 232.35 g/mol |
| IUPAC name | 5-[(2R,5S)-5-methylpiperidin-2-yl]-1,3-benzothiazole |
| InChIKey | UPSVNOIRQLCAMG-GXSJLCMTSA-N |
| SMILES | C[C@H]1CC[C@@H](NC1)C2=CC3=C(C=C2)SC=N3 |
Computed by PubChem (NCBI)