CAS 433254-87-6 is the registry number for 4-(4-Methylphenyl)-5-propyl-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-(4-methylphenyl)-5-propyl-1,3-thiazol-2-amine (CAS 433254-87-6) is a chemical compound with the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. IUPAC name: 4-(4-methylphenyl)-5-propyl-1,3-thiazol-2-amine. InChIKey: BFIWRBLVPZXIAN-UHFFFAOYSA-N.
| Molecular formula | C13H16N2S |
|---|---|
| Molecular weight | 232.35 g/mol |
| IUPAC name | 4-(4-methylphenyl)-5-propyl-1,3-thiazol-2-amine |
| InChIKey | BFIWRBLVPZXIAN-UHFFFAOYSA-N |
| SMILES | CCCC1=C(N=C(S1)N)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)