CAS 81529-61-5 appears in our catalog under these names: 4-(4-tert-Butylphenyl)thiazol-2-ylamine, 95%, 4-(4-tert-Butylphenyl)-1,3-thiazol-2-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
4-(4-tert-butylphenyl)-1,3-thiazol-2-amine (CAS 81529-61-5) is a chemical compound with the molecular formula C13H16N2S and a molecular weight of 232.35 g/mol. IUPAC name: 4-(4-tert-butylphenyl)-1,3-thiazol-2-amine. InChIKey: ABCNUVGFUGMTOA-UHFFFAOYSA-N.
| Molecular formula | C13H16N2S |
|---|---|
| Molecular weight | 232.35 g/mol |
| IUPAC name | 4-(4-tert-butylphenyl)-1,3-thiazol-2-amine |
| InChIKey | ABCNUVGFUGMTOA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)