CAS 1018584-61-6 appears in our catalog under these names: [5-(3-Methoxyphenyl)isoxazol-3-yl]acetic acid, 95%, 2-(5-(3-Methoxyphenyl)isoxazol-3-yl)acetic acid, 97%, 2-(5-(3-Methoxyphenyl)-1,2-oxazol-3-yl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 50mg, 0,5g.
2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetic acid (CAS 1018584-61-6) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetic acid. InChIKey: ZWHRIAJIMNCEDQ-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-[5-(3-methoxyphenyl)-1,2-oxazol-3-yl]acetic acid |
| InChIKey | ZWHRIAJIMNCEDQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=NO2)CC(=O)O |
Computed by PubChem (NCBI)