CAS 101860-72-4 is the registry number for 2-(3,4-Dichlorophenyl)-2H-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3,4-dichlorophenyl)triazole-4-carboxylic acid (CAS 101860-72-4) is a chemical compound with the molecular formula C9H5Cl2N3O2 and a molecular weight of 258.06 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)triazole-4-carboxylic acid. InChIKey: OHWGBXKYNGHMKV-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3O2 |
|---|---|
| Molecular weight | 258.06 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)triazole-4-carboxylic acid |
| InChIKey | OHWGBXKYNGHMKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2N=CC(=N2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)