CAS 1094673-43-4 is the registry number for 1-(3,4-Dichlorophenyl)-1H-1,2,3-triazole-4-carboxylic acid, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-(3,4-dichlorophenyl)triazole-4-carboxylic acid (CAS 1094673-43-4) is a chemical compound with the molecular formula C9H5Cl2N3O2 and a molecular weight of 258.06 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)triazole-4-carboxylic acid. InChIKey: NFHAUSBZPMOLNV-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3O2 |
|---|---|
| Molecular weight | 258.06 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)triazole-4-carboxylic acid |
| InChIKey | NFHAUSBZPMOLNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C=C(N=N2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)