Products 1094673-43-4

CAS 1094673-43-4 is the registry number for 1-(3,4-Dichlorophenyl)-1H-1,2,3-triazole-4-carboxylic acid, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(3,4-dichlorophenyl)triazole-4-carboxylic acid (CAS 1094673-43-4) is a chemical compound with the molecular formula C9H5Cl2N3O2 and a molecular weight of 258.06 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)triazole-4-carboxylic acid. InChIKey: NFHAUSBZPMOLNV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5Cl2N3O2
Molecular weight258.06 g/mol
IUPAC name1-(3,4-dichlorophenyl)triazole-4-carboxylic acid
InChIKeyNFHAUSBZPMOLNV-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1N2C=C(N=N2)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)