CAS 2883421-75-6 is the registry number for 6,9-Dichloro-2,3-dihydro-4H-1-oxa-3a,5,8-triazaphenalen-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,8-dichloro-10-oxa-1,3,7-triazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one (CAS 2883421-75-6) is a chemical compound with the molecular formula C9H5Cl2N3O2 and a molecular weight of 258.06 g/mol. IUPAC name: 4,8-dichloro-10-oxa-1,3,7-triazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one. InChIKey: WOJRTSNQMLOANP-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3O2 |
|---|---|
| Molecular weight | 258.06 g/mol |
| IUPAC name | 4,8-dichloro-10-oxa-1,3,7-triazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraen-2-one |
| InChIKey | WOJRTSNQMLOANP-UHFFFAOYSA-N |
| SMILES | C1COC2=C3N1C(=O)N=C(C3=CN=C2Cl)Cl |
Computed by PubChem (NCBI)