CAS 649579-09-9 is the registry number for 4,5-dichloro-1-(4-nitrophenyl)imidazole. Offered by: Biosynth. Available pack sizes: 10g, 25g.
4,5-dichloro-1-(4-nitrophenyl)imidazole (CAS 649579-09-9) is a chemical compound with the molecular formula C9H5Cl2N3O2 and a molecular weight of 258.06 g/mol. IUPAC name: 4,5-dichloro-1-(4-nitrophenyl)imidazole. InChIKey: SDXUKUVBETUBCS-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N3O2 |
|---|---|
| Molecular weight | 258.06 g/mol |
| IUPAC name | 4,5-dichloro-1-(4-nitrophenyl)imidazole |
| InChIKey | SDXUKUVBETUBCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=NC(=C2Cl)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)