CAS 1018996-02-5 is the registry number for 1-((1,5-Dimethyl-1H-pyrazol-4-yl)sulfonyl)piperidin-4-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(1,5-dimethylpyrazol-4-yl)sulfonylpiperidin-4-amine (CAS 1018996-02-5) is a chemical compound with the molecular formula C10H18N4O2S and a molecular weight of 258.34 g/mol. IUPAC name: 1-(1,5-dimethylpyrazol-4-yl)sulfonylpiperidin-4-amine. InChIKey: SWHQOYIKZPGDJC-UHFFFAOYSA-N.
| Molecular formula | C10H18N4O2S |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | 1-(1,5-dimethylpyrazol-4-yl)sulfonylpiperidin-4-amine |
| InChIKey | SWHQOYIKZPGDJC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C)S(=O)(=O)N2CCC(CC2)N |
Computed by PubChem (NCBI)