CAS 1019006-27-9 is the registry number for 1-((1-Ethyl-1H-pyrazol-4-yl)sulfonyl)piperidin-4-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(1-ethylpyrazol-4-yl)sulfonylpiperidin-4-amine (CAS 1019006-27-9) is a chemical compound with the molecular formula C10H18N4O2S and a molecular weight of 258.34 g/mol. IUPAC name: 1-(1-ethylpyrazol-4-yl)sulfonylpiperidin-4-amine. InChIKey: BGPWUPUFAAFZJE-UHFFFAOYSA-N.
| Molecular formula | C10H18N4O2S |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | 1-(1-ethylpyrazol-4-yl)sulfonylpiperidin-4-amine |
| InChIKey | BGPWUPUFAAFZJE-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C=N1)S(=O)(=O)N2CCC(CC2)N |
Computed by PubChem (NCBI)