Products 1172262-14-4
CAS 1172262-14-4 is the registry number for 1-((1-Ethyl-5-methyl-1H-pyrazol-4-yl)sulfonyl)piperazine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1-ethyl-5-methylpyrazol-4-yl)sulfonylpiperazine (CAS 1172262-14-4) is a chemical compound with the molecular formula C10H18N4O2S and a molecular weight of 258.34 g/mol. IUPAC name: 1-(1-ethyl-5-methylpyrazol-4-yl)sulfonylpiperazine. InChIKey: POBHVYAIFZUKSC-UHFFFAOYSA-N.
| Molecular formula | C10H18N4O2S |
|---|---|
| Molecular weight | 258.34 g/mol |
| IUPAC name | 1-(1-ethyl-5-methylpyrazol-4-yl)sulfonylpiperazine |
| InChIKey | POBHVYAIFZUKSC-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C=N1)S(=O)(=O)N2CCNCC2)C |
Computed by PubChem (NCBI)