CAS 101901-08-0 appears in our catalog under these names: 8-(1-Hydroxyethyl) Etodolac, Etodolac Impurity 15, 1’-Hydroxy Etodolac, 1’-Hydroxy etodolac. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg.
2-[1-ethyl-8-(1-hydroxyethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid (CAS 101901-08-0) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: 2-[1-ethyl-8-(1-hydroxyethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid. InChIKey: IIJKSRXOHAISPV-UHFFFAOYSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | 2-[1-ethyl-8-(1-hydroxyethyl)-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl]acetic acid |
| InChIKey | IIJKSRXOHAISPV-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(CCO1)C3=C(N2)C(=CC=C3)C(C)O)CC(=O)O |
Computed by PubChem (NCBI)