Products 1019019-92-1
CAS 1019019-92-1 is the registry number for 3-Formylimidazo(1,2-a)pyridine-6-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-formylimidazo[1,2-a]pyridine-6-carbonitrile (CAS 1019019-92-1) is a chemical compound with the molecular formula C9H5N3O and a molecular weight of 171.16 g/mol. IUPAC name: 3-formylimidazo[1,2-a]pyridine-6-carbonitrile. InChIKey: YSLAWDMCNJBCGA-UHFFFAOYSA-N.
| Molecular formula | C9H5N3O |
|---|---|
| Molecular weight | 171.16 g/mol |
| IUPAC name | 3-formylimidazo[1,2-a]pyridine-6-carbonitrile |
| InChIKey | YSLAWDMCNJBCGA-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1C#N)C=O |
Computed by PubChem (NCBI)